C20H19FN8OS — CID 34780226
6-[[5-cyclopropyl-4-(furan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-2-N-(4-fluorophenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 34780226) has the molecular formula C20H19FN8OS and a molecular weight of 438.49 g/mol. Its IUPAC name is 6-[[5-cyclopropyl-4-(furan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-2-N-(4-fluorophenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[[5-cyclopropyl-4-(furan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-2-N-(4-fluorophenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 34780226 |
| Molecular Formula | C20H19FN8OS |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | 6-[[5-cyclopropyl-4-(furan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-2-N-(4-fluorophenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(CSc2nnc(C3CC3)n2Cc2ccco2)nc(Nc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C20H19FN8OS/c21-13-5-7-14(8-6-13)23-19-25-16(24-18(22)26-19)11-31-20-28-27-17(12-3-4-12)29(20)10-15-2-1-9-30-15/h1-2,5-9,12H,3-4,10-11H2,(H3,22,23,24,25,26) |
| InChIKey | WXZMQOPZNWIVCS-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 120.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |