C18H17FN8S2 — CID 39415790
6-[(4-ethyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanylmethyl]-2-N-(4-fluorophenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 39415790) has the molecular formula C18H17FN8S2 and a molecular weight of 428.52 g/mol. Its IUPAC name is 6-[(4-ethyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanylmethyl]-2-N-(4-fluorophenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[(4-ethyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanylmethyl]-2-N-(4-fluorophenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 39415790 |
| Molecular Formula | C18H17FN8S2 |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | 6-[(4-ethyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanylmethyl]-2-N-(4-fluorophenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCn1c(SCc2nc(N)nc(Nc3ccc(F)cc3)n2)nnc1-c1cccs1 |
| InChI | InChI=1S/C18H17FN8S2/c1-2-27-15(13-4-3-9-28-13)25-26-18(27)29-10-14-22-16(20)24-17(23-14)21-12-7-5-11(19)6-8-12/h3-9H,2,10H2,1H3,(H3,20,21,22,23,24) |
| InChIKey | YPMSVWXHBRRURU-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 107.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |