C14H15FN8S — CID 9473852
6-[(4-ethyl-1,2,4-triazol-3-yl)sulfanylmethyl]-2-N-(4-fluorophenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 9473852) has the molecular formula C14H15FN8S and a molecular weight of 346.40 g/mol. Its IUPAC name is 6-[(4-ethyl-1,2,4-triazol-3-yl)sulfanylmethyl]-2-N-(4-fluorophenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[(4-ethyl-1,2,4-triazol-3-yl)sulfanylmethyl]-2-N-(4-fluorophenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 9473852 |
| Molecular Formula | C14H15FN8S |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 6-[(4-ethyl-1,2,4-triazol-3-yl)sulfanylmethyl]-2-N-(4-fluorophenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCn1cnnc1SCc1nc(N)nc(Nc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C14H15FN8S/c1-2-23-8-17-22-14(23)24-7-11-19-12(16)21-13(20-11)18-10-5-3-9(15)4-6-10/h3-6,8H,2,7H2,1H3,(H3,16,18,19,20,21) |
| InChIKey | COVGRJFQOFQJNC-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 107.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |