C22H24FN9OS — CID 42470447
2-N-(4-fluorophenyl)-6-[[4-(furan-2-ylmethyl)-5-piperidin-1-yl-1,2,4-triazol-3-yl]sulfanylmethyl]-1,3,5-triazine-2,4-diamine (PubChem CID 42470447) has the molecular formula C22H24FN9OS and a molecular weight of 481.56 g/mol. Its IUPAC name is 2-N-(4-fluorophenyl)-6-[[4-(furan-2-ylmethyl)-5-piperidin-1-yl-1,2,4-triazol-3-yl]sulfanylmethyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(4-fluorophenyl)-6-[[4-(furan-2-ylmethyl)-5-piperidin-1-yl-1,2,4-triazol-3-yl]sulfanylmethyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 42470447 |
| Molecular Formula | C22H24FN9OS |
| Molecular Weight | 481.56 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | 2-N-(4-fluorophenyl)-6-[[4-(furan-2-ylmethyl)-5-piperidin-1-yl-1,2,4-triazol-3-yl]sulfanylmethyl]-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(CSc2nnc(N3CCCCC3)n2Cc2ccco2)nc(Nc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C22H24FN9OS/c23-15-6-8-16(9-7-15)25-20-27-18(26-19(24)28-20)14-34-22-30-29-21(31-10-2-1-3-11-31)32(22)13-17-5-4-12-33-17/h4-9,12H,1-3,10-11,13-14H2,(H3,24,25,26,27,28) |
| InChIKey | ROHRKHSICUEYRD-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 123.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.56 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |