C20H20N2O3S — CID 3479153
2-hydroxy-2-(2-methoxyphenyl)-N'-(4-methylphenyl)-2-thiophen-2-ylacetohydrazide (PubChem CID 3479153) has the molecular formula C20H20N2O3S and a molecular weight of 368.46 g/mol. Its IUPAC name is 2-hydroxy-2-(2-methoxyphenyl)-N'-(4-methylphenyl)-2-thiophen-2-ylacetohydrazide.
| Compound Name | 2-hydroxy-2-(2-methoxyphenyl)-N'-(4-methylphenyl)-2-thiophen-2-ylacetohydrazide |
|---|---|
| PubChem CID | 3479153 |
| Molecular Formula | C20H20N2O3S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 2-hydroxy-2-(2-methoxyphenyl)-N'-(4-methylphenyl)-2-thiophen-2-ylacetohydrazide |
| SMILES | COc1ccccc1C(O)(C(=O)NNc1ccc(C)cc1)c1cccs1 |
| InChI | InChI=1S/C20H20N2O3S/c1-14-9-11-15(12-10-14)21-22-19(23)20(24,18-8-5-13-26-18)16-6-3-4-7-17(16)25-2/h3-13,21,24H,1-2H3,(H,22,23) |
| InChIKey | YHNMWCPCKCEWPG-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|