C18H15ClN2O2S — CID 3264601
N'-(3-chlorophenyl)-2-hydroxy-2-phenyl-2-thiophen-2-ylacetohydrazide (PubChem CID 3264601) has the molecular formula C18H15ClN2O2S and a molecular weight of 358.85 g/mol. Its IUPAC name is N'-(3-chlorophenyl)-2-hydroxy-2-phenyl-2-thiophen-2-ylacetohydrazide.
| Compound Name | N'-(3-chlorophenyl)-2-hydroxy-2-phenyl-2-thiophen-2-ylacetohydrazide |
|---|---|
| PubChem CID | 3264601 |
| Molecular Formula | C18H15ClN2O2S |
| Molecular Weight | 358.85 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | N'-(3-chlorophenyl)-2-hydroxy-2-phenyl-2-thiophen-2-ylacetohydrazide |
| SMILES | O=C(NNc1cccc(Cl)c1)C(O)(c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C18H15ClN2O2S/c19-14-8-4-9-15(12-14)20-21-17(22)18(23,16-10-5-11-24-16)13-6-2-1-3-7-13/h1-12,20,23H,(H,21,22) |
| InChIKey | IEKSGUYEBOKCPP-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.85 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|