C15H10N6O2S — CID 3479867
6-(3-nitrophenyl)-3-pyridin-3-yl-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine (PubChem CID 3479867) has the molecular formula C15H10N6O2S and a molecular weight of 338.35 g/mol. Its IUPAC name is 6-(3-nitrophenyl)-3-pyridin-3-yl-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine.
| Compound Name | 6-(3-nitrophenyl)-3-pyridin-3-yl-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine |
|---|---|
| PubChem CID | 3479867 |
| Molecular Formula | C15H10N6O2S |
| Molecular Weight | 338.35 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 6-(3-nitrophenyl)-3-pyridin-3-yl-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine |
| SMILES | O=[N+]([O-])c1cccc(C2=CSc3nnc(-c4cccnc4)n3N2)c1 |
| InChI | InChI=1S/C15H10N6O2S/c22-21(23)12-5-1-3-10(7-12)13-9-24-15-18-17-14(20(15)19-13)11-4-2-6-16-8-11/h1-9,19H |
| InChIKey | WOHQRGWWKMXLNI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.35 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|