C15H18N4O2S — CID 3484989
5-[(3-aminophenyl)iminomethyl]-1-butan-2-yl-6-hydroxy-2-sulfanylidenepyrimidin-4-one (PubChem CID 3484989) has the molecular formula C15H18N4O2S and a molecular weight of 318.40 g/mol. Its IUPAC name is 5-[(3-aminophenyl)iminomethyl]-1-butan-2-yl-6-hydroxy-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 5-[(3-aminophenyl)iminomethyl]-1-butan-2-yl-6-hydroxy-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 3484989 |
| Molecular Formula | C15H18N4O2S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 5-[(3-aminophenyl)iminomethyl]-1-butan-2-yl-6-hydroxy-2-sulfanylidenepyrimidin-4-one |
| SMILES | CCC(C)n1c(O)c(/C=N/c2cccc(N)c2)c(=O)[nH]c1=S |
| InChI | InChI=1S/C15H18N4O2S/c1-3-9(2)19-14(21)12(13(20)18-15(19)22)8-17-11-6-4-5-10(16)7-11/h4-9,21H,3,16H2,1-2H3,(H,18,20,22)/b17-8+ |
| InChIKey | NLTITNGMEFYTNK-CAOOACKPSA-N |
| XLogP | 2.92 |
| TPSA | 96.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|