C18H15N3O5S2 — CID 3485875
2-(3-methylphenyl)-5-[3-(4-nitrophenyl)sulfonylprop-2-enylsulfanyl]-1,3,4-oxadiazole (PubChem CID 3485875) has the molecular formula C18H15N3O5S2 and a molecular weight of 417.47 g/mol. Its IUPAC name is 2-(3-methylphenyl)-5-[3-(4-nitrophenyl)sulfonylprop-2-enylsulfanyl]-1,3,4-oxadiazole.
| Compound Name | 2-(3-methylphenyl)-5-[3-(4-nitrophenyl)sulfonylprop-2-enylsulfanyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 3485875 |
| Molecular Formula | C18H15N3O5S2 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.05 |
| IUPAC Name | 2-(3-methylphenyl)-5-[3-(4-nitrophenyl)sulfonylprop-2-enylsulfanyl]-1,3,4-oxadiazole |
| SMILES | Cc1cccc(-c2nnc(SCC=CS(=O)(=O)c3ccc([N+](=O)[O-])cc3)o2)c1 |
| InChI | InChI=1S/C18H15N3O5S2/c1-13-4-2-5-14(12-13)17-19-20-18(26-17)27-10-3-11-28(24,25)16-8-6-15(7-9-16)21(22)23/h2-9,11-12H,10H2,1H3 |
| InChIKey | ZRILCKCSNYAZQA-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 116.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|