C16H18NO2+ — CID 34883246
(2S,3S)-2-(4-methoxyphenyl)-3-methyl-1,3-dihydroindolizin-4-ium-2-ol (PubChem CID 34883246) has the molecular formula C16H18NO2+ and a molecular weight of 256.32 g/mol. Its IUPAC name is (2S,3S)-2-(4-methoxyphenyl)-3-methyl-1,3-dihydroindolizin-4-ium-2-ol.
| Compound Name | (2S,3S)-2-(4-methoxyphenyl)-3-methyl-1,3-dihydroindolizin-4-ium-2-ol |
|---|---|
| PubChem CID | 34883246 |
| Molecular Formula | C16H18NO2+ |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | (2S,3S)-2-(4-methoxyphenyl)-3-methyl-1,3-dihydroindolizin-4-ium-2-ol |
| SMILES | COc1ccc([C@@]2(O)Cc3cccc[n+]3[C@H]2C)cc1 |
| InChI | InChI=1S/C16H18NO2/c1-12-16(18,11-14-5-3-4-10-17(12)14)13-6-8-15(19-2)9-7-13/h3-10,12,18H,11H2,1-2H3/q+1/t12-,16+/m0/s1 |
| InChIKey | VTWQXBUTTJWDIQ-BLLLJJGKSA-N |
| XLogP | 1.99 |
| TPSA | 33.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|