C23H32N2O3 — CID 34886896
(1S)-2-(4-benzylpiperazin-1-yl)-1-[2-(2,6-dimethylphenoxy)ethoxy]ethanol (PubChem CID 34886896) has the molecular formula C23H32N2O3 and a molecular weight of 384.52 g/mol. Its IUPAC name is (1S)-2-(4-benzylpiperazin-1-yl)-1-[2-(2,6-dimethylphenoxy)ethoxy]ethanol.
| Compound Name | (1S)-2-(4-benzylpiperazin-1-yl)-1-[2-(2,6-dimethylphenoxy)ethoxy]ethanol |
|---|---|
| PubChem CID | 34886896 |
| Molecular Formula | C23H32N2O3 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | (1S)-2-(4-benzylpiperazin-1-yl)-1-[2-(2,6-dimethylphenoxy)ethoxy]ethanol |
| SMILES | Cc1cccc(C)c1OCCO[C@H](O)CN1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C23H32N2O3/c1-19-7-6-8-20(2)23(19)28-16-15-27-22(26)18-25-13-11-24(12-14-25)17-21-9-4-3-5-10-21/h3-10,22,26H,11-18H2,1-2H3/t22-/m0/s1 |
| InChIKey | KDRYWTJLQOOGNH-QFIPXVFZSA-N |
| XLogP | 2.84 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|