C15H23N3O3S — CID 34918587
N-butyl-2-[(2S)-2-methyl-5-sulfamoyl-2,3-dihydroindol-1-yl]acetamide (PubChem CID 34918587) has the molecular formula C15H23N3O3S and a molecular weight of 325.43 g/mol. Its IUPAC name is N-butyl-2-[(2S)-2-methyl-5-sulfamoyl-2,3-dihydroindol-1-yl]acetamide.
| Compound Name | N-butyl-2-[(2S)-2-methyl-5-sulfamoyl-2,3-dihydroindol-1-yl]acetamide |
|---|---|
| PubChem CID | 34918587 |
| Molecular Formula | C15H23N3O3S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | N-butyl-2-[(2S)-2-methyl-5-sulfamoyl-2,3-dihydroindol-1-yl]acetamide |
| SMILES | CCCCNC(=O)CN1c2ccc(S(N)(=O)=O)cc2C[C@@H]1C |
| InChI | InChI=1S/C15H23N3O3S/c1-3-4-7-17-15(19)10-18-11(2)8-12-9-13(22(16,20)21)5-6-14(12)18/h5-6,9,11H,3-4,7-8,10H2,1-2H3,(H,17,19)(H2,16,20,21)/t11-/m0/s1 |
| InChIKey | KIVUQZFHTSRTIR-NSHDSACASA-N |
| XLogP | 1.00 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|