About 5-(1-methoxypropyl)-1,3-benzodioxole
5-(1-methoxypropyl)-1,3-benzodioxole (PubChem CID 3496171) has the molecular formula C11H14O3
and a molecular weight of 194.23 g/mol. Its IUPAC name is 5-(1-methoxypropyl)-1,3-benzodioxole.
Molecular Properties
| Compound Name | 5-(1-methoxypropyl)-1,3-benzodioxole |
| PubChem CID | 3496171 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 5-(1-methoxypropyl)-1,3-benzodioxole |
| SMILES | CCC(OC)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C11H14O3/c1-3-9(12-2)8-4-5-10-11(6-8)14-7-13-10/h4-6,9H,3,7H2,1-2H3 |
| InChIKey | PBFANQACQQLPPK-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(1-methoxypropyl)-1,3-benzodioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1-methoxypropyl)-1,3-benzodioxole?
The IUPAC name of 5-(1-methoxypropyl)-1,3-benzodioxole (CID 3496171) is 5-(1-methoxypropyl)-1,3-benzodioxole.
What is the SMILES notation for 5-(1-methoxypropyl)-1,3-benzodioxole?
The canonical SMILES for 5-(1-methoxypropyl)-1,3-benzodioxole is CCC(OC)c1ccc2c(c1)OCO2.
What is the InChIKey of 5-(1-methoxypropyl)-1,3-benzodioxole?
The InChIKey is PBFANQACQQLPPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O3/c1-3-9(12-2)8-4-5-10-11(6-8)14-7-13-10/h4-6,9H,3,7H2,1-2H3.
What are the key properties of 5-(1-methoxypropyl)-1,3-benzodioxole?
5-(1-methoxypropyl)-1,3-benzodioxole has a molecular weight of 194.23 g/mol, XLogP of 2.51, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-methoxypropyl)-1,3-benzodioxole is sourced from PubChem (CID 3496171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).