C12H11N3OS — CID 3505189
1-(3-methyl-2-sulfanylidene-1H-imidazo[4,5-b]indol-4-yl)ethanone (PubChem CID 3505189) has the molecular formula C12H11N3OS and a molecular weight of 245.31 g/mol. Its IUPAC name is 1-(3-methyl-2-sulfanylidene-1H-imidazo[4,5-b]indol-4-yl)ethanone.
| Compound Name | 1-(3-methyl-2-sulfanylidene-1H-imidazo[4,5-b]indol-4-yl)ethanone |
|---|---|
| PubChem CID | 3505189 |
| Molecular Formula | C12H11N3OS |
| Molecular Weight | 245.31 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 1-(3-methyl-2-sulfanylidene-1H-imidazo[4,5-b]indol-4-yl)ethanone |
| SMILES | CC(=O)n1c2ccccc2c2[nH]c(=S)n(C)c21 |
| InChI | InChI=1S/C12H11N3OS/c1-7(16)15-9-6-4-3-5-8(9)10-11(15)14(2)12(17)13-10/h3-6H,1-2H3,(H,13,17) |
| InChIKey | VRZASQZHQNAVLW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 42.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.31 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|