C18H15Cl2NO4S4 — CID 3507118
5-chloro-N-[2-[2-(4-chlorophenyl)sulfonylethylsulfanyl]phenyl]thiophene-2-sulfonamide (PubChem CID 3507118) has the molecular formula C18H15Cl2NO4S4 and a molecular weight of 508.50 g/mol. Its IUPAC name is 5-chloro-N-[2-[2-(4-chlorophenyl)sulfonylethylsulfanyl]phenyl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[2-[2-(4-chlorophenyl)sulfonylethylsulfanyl]phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 3507118 |
| Molecular Formula | C18H15Cl2NO4S4 |
| Molecular Weight | 508.50 g/mol |
| Exact Mass | 506.93 |
| IUPAC Name | 5-chloro-N-[2-[2-(4-chlorophenyl)sulfonylethylsulfanyl]phenyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(CCSc1ccccc1NS(=O)(=O)c1ccc(Cl)s1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H15Cl2NO4S4/c19-13-5-7-14(8-6-13)28(22,23)12-11-26-16-4-2-1-3-15(16)21-29(24,25)18-10-9-17(20)27-18/h1-10,21H,11-12H2 |
| InChIKey | HHUUGDSVWBKUAT-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.50 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |