C21H19ClN2O3S2 — CID 2819515
1-[2-[2-(4-chlorophenyl)sulfonylethylsulfanyl]phenyl]-3-phenylurea (PubChem CID 2819515) has the molecular formula C21H19ClN2O3S2 and a molecular weight of 446.98 g/mol. Its IUPAC name is 1-[2-[2-(4-chlorophenyl)sulfonylethylsulfanyl]phenyl]-3-phenylurea.
| Compound Name | 1-[2-[2-(4-chlorophenyl)sulfonylethylsulfanyl]phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 2819515 |
| Molecular Formula | C21H19ClN2O3S2 |
| Molecular Weight | 446.98 g/mol |
| Exact Mass | 446.05 |
| IUPAC Name | 1-[2-[2-(4-chlorophenyl)sulfonylethylsulfanyl]phenyl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)Nc1ccccc1SCCS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H19ClN2O3S2/c22-16-10-12-18(13-11-16)29(26,27)15-14-28-20-9-5-4-8-19(20)24-21(25)23-17-6-2-1-3-7-17/h1-13H,14-15H2,(H2,23,24,25) |
| InChIKey | JGTGWOXOMIVFHI-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.98 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |