C27H23ClN2O3S — CID 3511193
5-[(6-chloro-1,3-benzodioxol-5-yl)methylidene]-3-(3,5-dimethylphenyl)-2-(3,5-dimethylphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 3511193) has the molecular formula C27H23ClN2O3S and a molecular weight of 491.01 g/mol. Its IUPAC name is 5-[(6-chloro-1,3-benzodioxol-5-yl)methylidene]-3-(3,5-dimethylphenyl)-2-(3,5-dimethylphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | 5-[(6-chloro-1,3-benzodioxol-5-yl)methylidene]-3-(3,5-dimethylphenyl)-2-(3,5-dimethylphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3511193 |
| Molecular Formula | C27H23ClN2O3S |
| Molecular Weight | 491.01 g/mol |
| Exact Mass | 490.11 |
| IUPAC Name | 5-[(6-chloro-1,3-benzodioxol-5-yl)methylidene]-3-(3,5-dimethylphenyl)-2-(3,5-dimethylphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | Cc1cc(C)cc(/N=C2\SC(=Cc3cc4c(cc3Cl)OCO4)C(=O)N2c2cc(C)cc(C)c2)c1 |
| InChI | InChI=1S/C27H23ClN2O3S/c1-15-5-16(2)8-20(7-15)29-27-30(21-9-17(3)6-18(4)10-21)26(31)25(34-27)12-19-11-23-24(13-22(19)28)33-14-32-23/h5-13H,14H2,1-4H3/b25-12?,29-27- |
| InChIKey | OOJBKVSXZCQMSW-USKTUCCUSA-N |
| XLogP | 7.11 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.01 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|