C24H18Cl2N2OS — CID 5057266
5-[(2,3-dichlorophenyl)methylidene]-3-(3-methylphenyl)-2-(3-methylphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 5057266) has the molecular formula C24H18Cl2N2OS and a molecular weight of 453.39 g/mol. Its IUPAC name is 5-[(2,3-dichlorophenyl)methylidene]-3-(3-methylphenyl)-2-(3-methylphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | 5-[(2,3-dichlorophenyl)methylidene]-3-(3-methylphenyl)-2-(3-methylphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 5057266 |
| Molecular Formula | C24H18Cl2N2OS |
| Molecular Weight | 453.39 g/mol |
| Exact Mass | 452.05 |
| IUPAC Name | 5-[(2,3-dichlorophenyl)methylidene]-3-(3-methylphenyl)-2-(3-methylphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | Cc1cccc(/N=C2\SC(=Cc3cccc(Cl)c3Cl)C(=O)N2c2cccc(C)c2)c1 |
| InChI | InChI=1S/C24H18Cl2N2OS/c1-15-6-3-9-18(12-15)27-24-28(19-10-4-7-16(2)13-19)23(29)21(30-24)14-17-8-5-11-20(25)22(17)26/h3-14H,1-2H3/b21-14?,27-24- |
| InChIKey | XHAKGAOJPZEEDV-FNDJROKJSA-N |
| XLogP | 7.42 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.39 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|