C30H43N3O2 — CID 3512620
[2-[3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 3,5,5-trimethylhexanoate (PubChem CID 3512620) has the molecular formula C30H43N3O2 and a molecular weight of 477.69 g/mol. Its IUPAC name is [2-[3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 3,5,5-trimethylhexanoate.
| Compound Name | [2-[3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 3,5,5-trimethylhexanoate |
|---|---|
| PubChem CID | 3512620 |
| Molecular Formula | C30H43N3O2 |
| Molecular Weight | 477.69 g/mol |
| Exact Mass | 477.34 |
| IUPAC Name | [2-[3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 3,5,5-trimethylhexanoate |
| SMILES | CC(CC(=O)Oc1ccccc1-c1nc2ccccn2c1NC(C)(C)CC(C)(C)C)CC(C)(C)C |
| InChI | InChI=1S/C30H43N3O2/c1-21(19-28(2,3)4)18-25(34)35-23-15-11-10-14-22(23)26-27(32-30(8,9)20-29(5,6)7)33-17-13-12-16-24(33)31-26/h10-17,21,32H,18-20H2,1-9H3 |
| InChIKey | KRQNFWJWFSXPBP-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.69 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|