C25H24ClNO3S — CID 35141310
N-[(3-chlorophenyl)methyl]-N-[(3S)-1,1-dioxothiolan-3-yl]-2,2-diphenylacetamide (PubChem CID 35141310) has the molecular formula C25H24ClNO3S and a molecular weight of 453.99 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-N-[(3S)-1,1-dioxothiolan-3-yl]-2,2-diphenylacetamide.
| Compound Name | N-[(3-chlorophenyl)methyl]-N-[(3S)-1,1-dioxothiolan-3-yl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 35141310 |
| Molecular Formula | C25H24ClNO3S |
| Molecular Weight | 453.99 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-N-[(3S)-1,1-dioxothiolan-3-yl]-2,2-diphenylacetamide |
| SMILES | O=C(C(c1ccccc1)c1ccccc1)N(Cc1cccc(Cl)c1)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C25H24ClNO3S/c26-22-13-7-8-19(16-22)17-27(23-14-15-31(29,30)18-23)25(28)24(20-9-3-1-4-10-20)21-11-5-2-6-12-21/h1-13,16,23-24H,14-15,17-18H2/t23-/m0/s1 |
| InChIKey | GOMZTIDQOBGHLM-QHCPKHFHSA-N |
| XLogP | 4.69 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.99 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |