C21H17ClN2O3S2 — CID 35230459
2-(3-chloro-N-methylsulfonylanilino)-N-[3-(2-thiophen-2-ylethynyl)phenyl]acetamide (PubChem CID 35230459) has the molecular formula C21H17ClN2O3S2 and a molecular weight of 444.97 g/mol. Its IUPAC name is 2-(3-chloro-N-methylsulfonylanilino)-N-[3-(2-thiophen-2-ylethynyl)phenyl]acetamide.
| Compound Name | 2-(3-chloro-N-methylsulfonylanilino)-N-[3-(2-thiophen-2-ylethynyl)phenyl]acetamide |
|---|---|
| PubChem CID | 35230459 |
| Molecular Formula | C21H17ClN2O3S2 |
| Molecular Weight | 444.97 g/mol |
| Exact Mass | 444.04 |
| IUPAC Name | 2-(3-chloro-N-methylsulfonylanilino)-N-[3-(2-thiophen-2-ylethynyl)phenyl]acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)Nc1cccc(C#Cc2cccs2)c1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C21H17ClN2O3S2/c1-29(26,27)24(19-8-3-6-17(22)14-19)15-21(25)23-18-7-2-5-16(13-18)10-11-20-9-4-12-28-20/h2-9,12-14H,15H2,1H3,(H,23,25) |
| InChIKey | JYXAYXXFVQMTNV-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.97 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|