C27H32ClN5O5 — CID 3523505
2-[8-(2-chloro-4-nitrobenzoyl)-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl]-N-(2-methylbutyl)acetamide (PubChem CID 3523505) has the molecular formula C27H32ClN5O5 and a molecular weight of 542.04 g/mol. Its IUPAC name is 2-[8-(2-chloro-4-nitrobenzoyl)-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl]-N-(2-methylbutyl)acetamide.
| Compound Name | 2-[8-(2-chloro-4-nitrobenzoyl)-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl]-N-(2-methylbutyl)acetamide |
|---|---|
| PubChem CID | 3523505 |
| Molecular Formula | C27H32ClN5O5 |
| Molecular Weight | 542.04 g/mol |
| Exact Mass | 541.21 |
| IUPAC Name | 2-[8-(2-chloro-4-nitrobenzoyl)-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl]-N-(2-methylbutyl)acetamide |
| SMILES | CCC(C)CNC(=O)CN1CN(c2ccccc2)C2(CCN(C(=O)c3ccc([N+](=O)[O-])cc3Cl)CC2)C1=O |
| InChI | InChI=1S/C27H32ClN5O5/c1-3-19(2)16-29-24(34)17-31-18-32(20-7-5-4-6-8-20)27(26(31)36)11-13-30(14-12-27)25(35)22-10-9-21(33(37)38)15-23(22)28/h4-10,15,19H,3,11-14,16-18H2,1-2H3,(H,29,34) |
| InChIKey | PWCBJEMWOGFNPX-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 116.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.04 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|