C25H32N4O6S — CID 3524786
N-[5-[2-(3,4-dimethoxyphenyl)ethylamino]-1,3,4-thiadiazol-2-yl]-3,4,5-triethoxybenzamide (PubChem CID 3524786) has the molecular formula C25H32N4O6S and a molecular weight of 516.62 g/mol. Its IUPAC name is N-[5-[2-(3,4-dimethoxyphenyl)ethylamino]-1,3,4-thiadiazol-2-yl]-3,4,5-triethoxybenzamide.
| Compound Name | N-[5-[2-(3,4-dimethoxyphenyl)ethylamino]-1,3,4-thiadiazol-2-yl]-3,4,5-triethoxybenzamide |
|---|---|
| PubChem CID | 3524786 |
| Molecular Formula | C25H32N4O6S |
| Molecular Weight | 516.62 g/mol |
| Exact Mass | 516.20 |
| IUPAC Name | N-[5-[2-(3,4-dimethoxyphenyl)ethylamino]-1,3,4-thiadiazol-2-yl]-3,4,5-triethoxybenzamide |
| SMILES | CCOc1cc(C(=O)Nc2nnc(NCCc3ccc(OC)c(OC)c3)s2)cc(OCC)c1OCC |
| InChI | InChI=1S/C25H32N4O6S/c1-6-33-20-14-17(15-21(34-7-2)22(20)35-8-3)23(30)27-25-29-28-24(36-25)26-12-11-16-9-10-18(31-4)19(13-16)32-5/h9-10,13-15H,6-8,11-12H2,1-5H3,(H,26,28)(H,27,29,30) |
| InChIKey | NBIGMBLFYZGIAZ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 113.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.62 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |