C18H16N2O3S2 — CID 35271878
4-[5-[2-(butanoylamino)-1,3-thiazol-4-yl]thiophen-2-yl]benzoic acid (PubChem CID 35271878) has the molecular formula C18H16N2O3S2 and a molecular weight of 372.47 g/mol. Its IUPAC name is 4-[5-[2-(butanoylamino)-1,3-thiazol-4-yl]thiophen-2-yl]benzoic acid.
| Compound Name | 4-[5-[2-(butanoylamino)-1,3-thiazol-4-yl]thiophen-2-yl]benzoic acid |
|---|---|
| PubChem CID | 35271878 |
| Molecular Formula | C18H16N2O3S2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | 4-[5-[2-(butanoylamino)-1,3-thiazol-4-yl]thiophen-2-yl]benzoic acid |
| SMILES | CCCC(=O)Nc1nc(-c2ccc(-c3ccc(C(=O)O)cc3)s2)cs1 |
| InChI | InChI=1S/C18H16N2O3S2/c1-2-3-16(21)20-18-19-13(10-24-18)15-9-8-14(25-15)11-4-6-12(7-5-11)17(22)23/h4-10H,2-3H2,1H3,(H,22,23)(H,19,20,21) |
| InChIKey | OZCHHJLSIBPERQ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |