C14H13Cl2NS2 — CID 3529923
2-[(2,2-dichlorocyclopropyl)methylsulfanyl]-4-(4-methylphenyl)-1,3-thiazole (PubChem CID 3529923) has the molecular formula C14H13Cl2NS2 and a molecular weight of 330.31 g/mol. Its IUPAC name is 2-[(2,2-dichlorocyclopropyl)methylsulfanyl]-4-(4-methylphenyl)-1,3-thiazole.
| Compound Name | 2-[(2,2-dichlorocyclopropyl)methylsulfanyl]-4-(4-methylphenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 3529923 |
| Molecular Formula | C14H13Cl2NS2 |
| Molecular Weight | 330.31 g/mol |
| Exact Mass | 328.99 |
| IUPAC Name | 2-[(2,2-dichlorocyclopropyl)methylsulfanyl]-4-(4-methylphenyl)-1,3-thiazole |
| SMILES | Cc1ccc(-c2csc(SCC3CC3(Cl)Cl)n2)cc1 |
| InChI | InChI=1S/C14H13Cl2NS2/c1-9-2-4-10(5-3-9)12-8-19-13(17-12)18-7-11-6-14(11,15)16/h2-5,8,11H,6-7H2,1H3 |
| InChIKey | WKINJDGXFCQSLR-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.31 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|