C22H26N2O6 — CID 35310394
(3-acetyl-2,4,6-trimethylphenyl)methyl 4-(2-methoxyethylamino)-3-nitrobenzoate (PubChem CID 35310394) has the molecular formula C22H26N2O6 and a molecular weight of 414.46 g/mol. Its IUPAC name is (3-acetyl-2,4,6-trimethylphenyl)methyl 4-(2-methoxyethylamino)-3-nitrobenzoate.
| Compound Name | (3-acetyl-2,4,6-trimethylphenyl)methyl 4-(2-methoxyethylamino)-3-nitrobenzoate |
|---|---|
| PubChem CID | 35310394 |
| Molecular Formula | C22H26N2O6 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | (3-acetyl-2,4,6-trimethylphenyl)methyl 4-(2-methoxyethylamino)-3-nitrobenzoate |
| SMILES | COCCNc1ccc(C(=O)OCc2c(C)cc(C)c(C(C)=O)c2C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H26N2O6/c1-13-10-14(2)21(16(4)25)15(3)18(13)12-30-22(26)17-6-7-19(23-8-9-29-5)20(11-17)24(27)28/h6-7,10-11,23H,8-9,12H2,1-5H3 |
| InChIKey | MYUKDIUGLFOGTB-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|