C18H26F3N3O2S — CID 35317151
1-[(3R)-3-methylpiperidin-1-yl]sulfonyl-4-[[4-(trifluoromethyl)phenyl]methyl]piperazine (PubChem CID 35317151) has the molecular formula C18H26F3N3O2S and a molecular weight of 405.49 g/mol. Its IUPAC name is 1-[(3R)-3-methylpiperidin-1-yl]sulfonyl-4-[[4-(trifluoromethyl)phenyl]methyl]piperazine.
| Compound Name | 1-[(3R)-3-methylpiperidin-1-yl]sulfonyl-4-[[4-(trifluoromethyl)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 35317151 |
| Molecular Formula | C18H26F3N3O2S |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 1-[(3R)-3-methylpiperidin-1-yl]sulfonyl-4-[[4-(trifluoromethyl)phenyl]methyl]piperazine |
| SMILES | C[C@@H]1CCCN(S(=O)(=O)N2CCN(Cc3ccc(C(F)(F)F)cc3)CC2)C1 |
| InChI | InChI=1S/C18H26F3N3O2S/c1-15-3-2-8-24(13-15)27(25,26)23-11-9-22(10-12-23)14-16-4-6-17(7-5-16)18(19,20)21/h4-7,15H,2-3,8-14H2,1H3/t15-/m1/s1 |
| InChIKey | RWUBHIOCMGDXRH-OAHLLOKOSA-N |
| XLogP | 2.80 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |