C27H28N2O3 — CID 35342667
N-ethyl-N-[(R)-1H-indol-3-yl-(4-methoxyphenyl)methyl]-2-(4-methylphenoxy)acetamide (PubChem CID 35342667) has the molecular formula C27H28N2O3 and a molecular weight of 428.53 g/mol. Its IUPAC name is N-ethyl-N-[(R)-1H-indol-3-yl-(4-methoxyphenyl)methyl]-2-(4-methylphenoxy)acetamide.
| Compound Name | N-ethyl-N-[(R)-1H-indol-3-yl-(4-methoxyphenyl)methyl]-2-(4-methylphenoxy)acetamide |
|---|---|
| PubChem CID | 35342667 |
| Molecular Formula | C27H28N2O3 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | N-ethyl-N-[(R)-1H-indol-3-yl-(4-methoxyphenyl)methyl]-2-(4-methylphenoxy)acetamide |
| SMILES | CCN(C(=O)COc1ccc(C)cc1)[C@H](c1ccc(OC)cc1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C27H28N2O3/c1-4-29(26(30)18-32-22-13-9-19(2)10-14-22)27(20-11-15-21(31-3)16-12-20)24-17-28-25-8-6-5-7-23(24)25/h5-17,27-28H,4,18H2,1-3H3/t27-/m1/s1 |
| InChIKey | NYFLEFZEKOXQNG-HHHXNRCGSA-N |
| XLogP | 5.50 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |