C26H25ClN2O2 — CID 35344435
2-(4-chlorophenoxy)-N-ethyl-N-[(S)-1H-indol-3-yl-(4-methylphenyl)methyl]acetamide (PubChem CID 35344435) has the molecular formula C26H25ClN2O2 and a molecular weight of 432.95 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-ethyl-N-[(S)-1H-indol-3-yl-(4-methylphenyl)methyl]acetamide.
| Compound Name | 2-(4-chlorophenoxy)-N-ethyl-N-[(S)-1H-indol-3-yl-(4-methylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 35344435 |
| Molecular Formula | C26H25ClN2O2 |
| Molecular Weight | 432.95 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-ethyl-N-[(S)-1H-indol-3-yl-(4-methylphenyl)methyl]acetamide |
| SMILES | CCN(C(=O)COc1ccc(Cl)cc1)[C@@H](c1ccc(C)cc1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C26H25ClN2O2/c1-3-29(25(30)17-31-21-14-12-20(27)13-15-21)26(19-10-8-18(2)9-11-19)23-16-28-24-7-5-4-6-22(23)24/h4-16,26,28H,3,17H2,1-2H3/t26-/m0/s1 |
| InChIKey | COSZDQGRKRMTTO-SANMLTNESA-N |
| XLogP | 6.15 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.95 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |