C27H28N2O4 — CID 35344358
N-ethyl-N-[(R)-1H-indol-3-yl-(4-methoxyphenyl)methyl]-2-(2-methoxyphenoxy)acetamide (PubChem CID 35344358) has the molecular formula C27H28N2O4 and a molecular weight of 444.53 g/mol. Its IUPAC name is N-ethyl-N-[(R)-1H-indol-3-yl-(4-methoxyphenyl)methyl]-2-(2-methoxyphenoxy)acetamide.
| Compound Name | N-ethyl-N-[(R)-1H-indol-3-yl-(4-methoxyphenyl)methyl]-2-(2-methoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 35344358 |
| Molecular Formula | C27H28N2O4 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | N-ethyl-N-[(R)-1H-indol-3-yl-(4-methoxyphenyl)methyl]-2-(2-methoxyphenoxy)acetamide |
| SMILES | CCN(C(=O)COc1ccccc1OC)[C@H](c1ccc(OC)cc1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C27H28N2O4/c1-4-29(26(30)18-33-25-12-8-7-11-24(25)32-3)27(19-13-15-20(31-2)16-14-19)22-17-28-23-10-6-5-9-21(22)23/h5-17,27-28H,4,18H2,1-3H3/t27-/m1/s1 |
| InChIKey | NOKBAHJOVQNKMK-HHHXNRCGSA-N |
| XLogP | 5.20 |
| TPSA | 63.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |