C24H22N2O3 — CID 3535073
N'-[1-(4-phenylphenyl)prop-1-enyl]-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide (PubChem CID 3535073) has the molecular formula C24H22N2O3 and a molecular weight of 386.45 g/mol. Its IUPAC name is N'-[1-(4-phenylphenyl)prop-1-enyl]-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide.
| Compound Name | N'-[1-(4-phenylphenyl)prop-1-enyl]-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide |
|---|---|
| PubChem CID | 3535073 |
| Molecular Formula | C24H22N2O3 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | N'-[1-(4-phenylphenyl)prop-1-enyl]-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide |
| SMILES | CC=C(NNC(=O)C1COc2ccccc2O1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H22N2O3/c1-2-20(19-14-12-18(13-15-19)17-8-4-3-5-9-17)25-26-24(27)23-16-28-21-10-6-7-11-22(21)29-23/h2-15,23,25H,16H2,1H3,(H,26,27) |
| InChIKey | SUXLCGIBFZYXOL-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|