C24H25FN4O3 — CID 35366950
4-[4-[2-(4-fluorophenyl)acetyl]piperazine-1-carbonyl]-2-propylphthalazin-1-one (PubChem CID 35366950) has the molecular formula C24H25FN4O3 and a molecular weight of 436.49 g/mol. Its IUPAC name is 4-[4-[2-(4-fluorophenyl)acetyl]piperazine-1-carbonyl]-2-propylphthalazin-1-one.
| Compound Name | 4-[4-[2-(4-fluorophenyl)acetyl]piperazine-1-carbonyl]-2-propylphthalazin-1-one |
|---|---|
| PubChem CID | 35366950 |
| Molecular Formula | C24H25FN4O3 |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 4-[4-[2-(4-fluorophenyl)acetyl]piperazine-1-carbonyl]-2-propylphthalazin-1-one |
| SMILES | CCCn1nc(C(=O)N2CCN(C(=O)Cc3ccc(F)cc3)CC2)c2ccccc2c1=O |
| InChI | InChI=1S/C24H25FN4O3/c1-2-11-29-23(31)20-6-4-3-5-19(20)22(26-29)24(32)28-14-12-27(13-15-28)21(30)16-17-7-9-18(25)10-8-17/h3-10H,2,11-16H2,1H3 |
| InChIKey | QYDBZNPWGXZJOR-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |