C24H33N5O4 — CID 55496276
4-[4-(2-morpholin-4-ylacetyl)piperazine-1-carbonyl]-2-pentylphthalazin-1-one (PubChem CID 55496276) has the molecular formula C24H33N5O4 and a molecular weight of 455.56 g/mol. Its IUPAC name is 4-[4-(2-morpholin-4-ylacetyl)piperazine-1-carbonyl]-2-pentylphthalazin-1-one.
| Compound Name | 4-[4-(2-morpholin-4-ylacetyl)piperazine-1-carbonyl]-2-pentylphthalazin-1-one |
|---|---|
| PubChem CID | 55496276 |
| Molecular Formula | C24H33N5O4 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.25 |
| IUPAC Name | 4-[4-(2-morpholin-4-ylacetyl)piperazine-1-carbonyl]-2-pentylphthalazin-1-one |
| SMILES | CCCCCn1nc(C(=O)N2CCN(C(=O)CN3CCOCC3)CC2)c2ccccc2c1=O |
| InChI | InChI=1S/C24H33N5O4/c1-2-3-6-9-29-23(31)20-8-5-4-7-19(20)22(25-29)24(32)28-12-10-27(11-13-28)21(30)18-26-14-16-33-17-15-26/h4-5,7-8H,2-3,6,9-18H2,1H3 |
| InChIKey | NQDRPOIOYIXQGU-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 87.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|