C21H30N4O4S — CID 56544691
4-[4-(2-methylsulfonylethyl)piperazine-1-carbonyl]-2-pentylphthalazin-1-one (PubChem CID 56544691) has the molecular formula C21H30N4O4S and a molecular weight of 434.56 g/mol. Its IUPAC name is 4-[4-(2-methylsulfonylethyl)piperazine-1-carbonyl]-2-pentylphthalazin-1-one.
| Compound Name | 4-[4-(2-methylsulfonylethyl)piperazine-1-carbonyl]-2-pentylphthalazin-1-one |
|---|---|
| PubChem CID | 56544691 |
| Molecular Formula | C21H30N4O4S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 4-[4-(2-methylsulfonylethyl)piperazine-1-carbonyl]-2-pentylphthalazin-1-one |
| SMILES | CCCCCn1nc(C(=O)N2CCN(CCS(C)(=O)=O)CC2)c2ccccc2c1=O |
| InChI | InChI=1S/C21H30N4O4S/c1-3-4-7-10-25-20(26)18-9-6-5-8-17(18)19(22-25)21(27)24-13-11-23(12-14-24)15-16-30(2,28)29/h5-6,8-9H,3-4,7,10-16H2,1-2H3 |
| InChIKey | OGCZQJVNGIPBEF-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 92.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|