C20H27ClN4O2 — CID 120656192
4-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]-2-pentylphthalazin-1-one;hydrochloride (PubChem CID 120656192) has the molecular formula C20H27ClN4O2 and a molecular weight of 390.92 g/mol. Its IUPAC name is 4-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]-2-pentylphthalazin-1-one;hydrochloride.
| Compound Name | 4-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]-2-pentylphthalazin-1-one;hydrochloride |
|---|---|
| PubChem CID | 120656192 |
| Molecular Formula | C20H27ClN4O2 |
| Molecular Weight | 390.92 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 4-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]-2-pentylphthalazin-1-one;hydrochloride |
| SMILES | CCCCCn1nc(C(=O)N2C[C@H]3CNC[C@H]3C2)c2ccccc2c1=O.Cl |
| InChI | InChI=1S/C20H26N4O2.ClH/c1-2-3-6-9-24-19(25)17-8-5-4-7-16(17)18(22-24)20(26)23-12-14-10-21-11-15(14)13-23;/h4-5,7-8,14-15,21H,2-3,6,9-13H2,1H3;1H/t14-,15+; |
| InChIKey | AAVUKFJCHMAXEG-KBGJBQQCSA-N |
| XLogP | 2.30 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.92 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|