C20H29ClN4O2 — CID 120810332
4-[3-(aminomethyl)-3-methylpyrrolidine-1-carbonyl]-2-pentylphthalazin-1-one;hydrochloride (PubChem CID 120810332) has the molecular formula C20H29ClN4O2 and a molecular weight of 392.93 g/mol. Its IUPAC name is 4-[3-(aminomethyl)-3-methylpyrrolidine-1-carbonyl]-2-pentylphthalazin-1-one;hydrochloride.
| Compound Name | 4-[3-(aminomethyl)-3-methylpyrrolidine-1-carbonyl]-2-pentylphthalazin-1-one;hydrochloride |
|---|---|
| PubChem CID | 120810332 |
| Molecular Formula | C20H29ClN4O2 |
| Molecular Weight | 392.93 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | 4-[3-(aminomethyl)-3-methylpyrrolidine-1-carbonyl]-2-pentylphthalazin-1-one;hydrochloride |
| SMILES | CCCCCn1nc(C(=O)N2CCC(C)(CN)C2)c2ccccc2c1=O.Cl |
| InChI | InChI=1S/C20H28N4O2.ClH/c1-3-4-7-11-24-18(25)16-9-6-5-8-15(16)17(22-24)19(26)23-12-10-20(2,13-21)14-23;/h5-6,8-9H,3-4,7,10-14,21H2,1-2H3;1H |
| InChIKey | HWFGPWRVPVQIIN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.93 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|