C25H30N4O3 — CID 171630980
4-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-2-pentylphthalazin-1-one (PubChem CID 171630980) has the molecular formula C25H30N4O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is 4-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-2-pentylphthalazin-1-one.
| Compound Name | 4-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-2-pentylphthalazin-1-one |
|---|---|
| PubChem CID | 171630980 |
| Molecular Formula | C25H30N4O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | 4-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-2-pentylphthalazin-1-one |
| SMILES | CCCCCn1nc(C(=O)N2CCN(c3ccc(OC)cc3)CC2)c2ccccc2c1=O |
| InChI | InChI=1S/C25H30N4O3/c1-3-4-7-14-29-24(30)22-9-6-5-8-21(22)23(26-29)25(31)28-17-15-27(16-18-28)19-10-12-20(32-2)13-11-19/h5-6,8-13H,3-4,7,14-18H2,1-2H3 |
| InChIKey | PIBZZLJKSWFKLE-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|