C25H26ClFN4O3 — CID 55716724
4-[4-(5-chloro-2-fluorobenzoyl)piperazine-1-carbonyl]-2-pentylphthalazin-1-one (PubChem CID 55716724) has the molecular formula C25H26ClFN4O3 and a molecular weight of 484.96 g/mol. Its IUPAC name is 4-[4-(5-chloro-2-fluorobenzoyl)piperazine-1-carbonyl]-2-pentylphthalazin-1-one.
| Compound Name | 4-[4-(5-chloro-2-fluorobenzoyl)piperazine-1-carbonyl]-2-pentylphthalazin-1-one |
|---|---|
| PubChem CID | 55716724 |
| Molecular Formula | C25H26ClFN4O3 |
| Molecular Weight | 484.96 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | 4-[4-(5-chloro-2-fluorobenzoyl)piperazine-1-carbonyl]-2-pentylphthalazin-1-one |
| SMILES | CCCCCn1nc(C(=O)N2CCN(C(=O)c3cc(Cl)ccc3F)CC2)c2ccccc2c1=O |
| InChI | InChI=1S/C25H26ClFN4O3/c1-2-3-6-11-31-24(33)19-8-5-4-7-18(19)22(28-31)25(34)30-14-12-29(13-15-30)23(32)20-16-17(26)9-10-21(20)27/h4-5,7-10,16H,2-3,6,11-15H2,1H3 |
| InChIKey | XBMZXAOTORFOLP-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.96 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|