C21H23NO6 — CID 3539693
1,3-benzodioxol-5-yl 2-[(4-ethoxybenzoyl)amino]-3-methylbutanoate (PubChem CID 3539693) has the molecular formula C21H23NO6 and a molecular weight of 385.42 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl 2-[(4-ethoxybenzoyl)amino]-3-methylbutanoate.
| Compound Name | 1,3-benzodioxol-5-yl 2-[(4-ethoxybenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 3539693 |
| Molecular Formula | C21H23NO6 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 1,3-benzodioxol-5-yl 2-[(4-ethoxybenzoyl)amino]-3-methylbutanoate |
| SMILES | CCOc1ccc(C(=O)NC(C(=O)Oc2ccc3c(c2)OCO3)C(C)C)cc1 |
| InChI | InChI=1S/C21H23NO6/c1-4-25-15-7-5-14(6-8-15)20(23)22-19(13(2)3)21(24)28-16-9-10-17-18(11-16)27-12-26-17/h5-11,13,19H,4,12H2,1-3H3,(H,22,23) |
| InChIKey | QOBHNSRICSVOLS-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|