C16H15NO4S — CID 3544443
methyl 3-(4-anilino-3,6-dioxocyclohexa-1,4-dien-1-yl)sulfanylpropanoate (PubChem CID 3544443) has the molecular formula C16H15NO4S and a molecular weight of 317.37 g/mol. Its IUPAC name is methyl 3-(4-anilino-3,6-dioxocyclohexa-1,4-dien-1-yl)sulfanylpropanoate.
| Compound Name | methyl 3-(4-anilino-3,6-dioxocyclohexa-1,4-dien-1-yl)sulfanylpropanoate |
|---|---|
| PubChem CID | 3544443 |
| Molecular Formula | C16H15NO4S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | methyl 3-(4-anilino-3,6-dioxocyclohexa-1,4-dien-1-yl)sulfanylpropanoate |
| SMILES | COC(=O)CCSC1=CC(=O)C(Nc2ccccc2)=CC1=O |
| InChI | InChI=1S/C16H15NO4S/c1-21-16(20)7-8-22-15-10-13(18)12(9-14(15)19)17-11-5-3-2-4-6-11/h2-6,9-10,17H,7-8H2,1H3 |
| InChIKey | KJHSQFZWSLBYKC-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|