C12H10N4O6 — CID 3550295
2-(2,4-dioxopyrimidin-1-yl)-N-(4-hydroxy-3-nitrophenyl)acetamide (PubChem CID 3550295) has the molecular formula C12H10N4O6 and a molecular weight of 306.23 g/mol. Its IUPAC name is 2-(2,4-dioxopyrimidin-1-yl)-N-(4-hydroxy-3-nitrophenyl)acetamide.
| Compound Name | 2-(2,4-dioxopyrimidin-1-yl)-N-(4-hydroxy-3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 3550295 |
| Molecular Formula | C12H10N4O6 |
| Molecular Weight | 306.23 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 2-(2,4-dioxopyrimidin-1-yl)-N-(4-hydroxy-3-nitrophenyl)acetamide |
| SMILES | O=C(Cn1ccc(=O)[nH]c1=O)Nc1ccc(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H10N4O6/c17-9-2-1-7(5-8(9)16(21)22)13-11(19)6-15-4-3-10(18)14-12(15)20/h1-5,17H,6H2,(H,13,19)(H,14,18,20) |
| InChIKey | HIYZMSMAHUDEIQ-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 147.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.23 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|