C10H6FN3O5 — CID 22217097
5-fluoro-1-(4-hydroxy-3-nitrophenyl)pyrimidine-2,4-dione (PubChem CID 22217097) has the molecular formula C10H6FN3O5 and a molecular weight of 267.17 g/mol. Its IUPAC name is 5-fluoro-1-(4-hydroxy-3-nitrophenyl)pyrimidine-2,4-dione.
| Compound Name | 5-fluoro-1-(4-hydroxy-3-nitrophenyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 22217097 |
| Molecular Formula | C10H6FN3O5 |
| Molecular Weight | 267.17 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | 5-fluoro-1-(4-hydroxy-3-nitrophenyl)pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(-c2ccc(O)c([N+](=O)[O-])c2)cc1F |
| InChI | InChI=1S/C10H6FN3O5/c11-6-4-13(10(17)12-9(6)16)5-1-2-8(15)7(3-5)14(18)19/h1-4,15H,(H,12,16,17) |
| InChIKey | GZRVNNMWHHVPAG-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 118.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.17 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|