C12H12F3N3O4 — CID 18783783
2,2,2-trifluoro-1-[4-(4-hydroxy-3-nitrophenyl)piperazin-1-yl]ethanone (PubChem CID 18783783) has the molecular formula C12H12F3N3O4 and a molecular weight of 319.24 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[4-(4-hydroxy-3-nitrophenyl)piperazin-1-yl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[4-(4-hydroxy-3-nitrophenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 18783783 |
| Molecular Formula | C12H12F3N3O4 |
| Molecular Weight | 319.24 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 2,2,2-trifluoro-1-[4-(4-hydroxy-3-nitrophenyl)piperazin-1-yl]ethanone |
| SMILES | O=C(N1CCN(c2ccc(O)c([N+](=O)[O-])c2)CC1)C(F)(F)F |
| InChI | InChI=1S/C12H12F3N3O4/c13-12(14,15)11(20)17-5-3-16(4-6-17)8-1-2-10(19)9(7-8)18(21)22/h1-2,7,19H,3-6H2 |
| InChIKey | AZRXYTHYYCKJDV-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 86.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.24 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|