C20H21NO4 — CID 35526728
N,N-bis(furan-2-ylmethyl)-2-propoxybenzamide (PubChem CID 35526728) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is N,N-bis(furan-2-ylmethyl)-2-propoxybenzamide.
| Compound Name | N,N-bis(furan-2-ylmethyl)-2-propoxybenzamide |
|---|---|
| PubChem CID | 35526728 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | N,N-bis(furan-2-ylmethyl)-2-propoxybenzamide |
| SMILES | CCCOc1ccccc1C(=O)N(Cc1ccco1)Cc1ccco1 |
| InChI | InChI=1S/C20H21NO4/c1-2-11-25-19-10-4-3-9-18(19)20(22)21(14-16-7-5-12-23-16)15-17-8-6-13-24-17/h3-10,12-13H,2,11,14-15H2,1H3 |
| InChIKey | IGRYXILABQIHIK-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 55.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |