C19H21F3N4O2 — CID 35528555
[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[1-[[3-(trifluoromethyl)phenoxy]methyl]pyrazol-3-yl]methanone (PubChem CID 35528555) has the molecular formula C19H21F3N4O2 and a molecular weight of 394.40 g/mol. Its IUPAC name is [(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[1-[[3-(trifluoromethyl)phenoxy]methyl]pyrazol-3-yl]methanone.
| Compound Name | [(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[1-[[3-(trifluoromethyl)phenoxy]methyl]pyrazol-3-yl]methanone |
|---|---|
| PubChem CID | 35528555 |
| Molecular Formula | C19H21F3N4O2 |
| Molecular Weight | 394.40 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | [(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[1-[[3-(trifluoromethyl)phenoxy]methyl]pyrazol-3-yl]methanone |
| SMILES | O=C(c1ccn(COc2cccc(C(F)(F)F)c2)n1)N1CCN2CCC[C@H]2C1 |
| InChI | InChI=1S/C19H21F3N4O2/c20-19(21,22)14-3-1-5-16(11-14)28-13-26-8-6-17(23-26)18(27)25-10-9-24-7-2-4-15(24)12-25/h1,3,5-6,8,11,15H,2,4,7,9-10,12-13H2/t15-/m0/s1 |
| InChIKey | RHHAVWBNNZNRRC-HNNXBMFYSA-N |
| XLogP | 2.86 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.40 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |