C15H20N2O3 — CID 35537550
N-butyl-5-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]furan-2-carboxamide (PubChem CID 35537550) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is N-butyl-5-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]furan-2-carboxamide.
| Compound Name | N-butyl-5-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 35537550 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | N-butyl-5-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]furan-2-carboxamide |
| SMILES | CCCCNC(=O)c1ccc(Cc2c(C)noc2C)o1 |
| InChI | InChI=1S/C15H20N2O3/c1-4-5-8-16-15(18)14-7-6-12(19-14)9-13-10(2)17-20-11(13)3/h6-7H,4-5,8-9H2,1-3H3,(H,16,18) |
| InChIKey | ZSJWVLZRKXCYCC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|