C19H24N2O5S2 — CID 35539470
2-[(2,5-dimethoxyphenyl)sulfonylamino]-N-ethyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 35539470) has the molecular formula C19H24N2O5S2 and a molecular weight of 424.54 g/mol. Its IUPAC name is 2-[(2,5-dimethoxyphenyl)sulfonylamino]-N-ethyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[(2,5-dimethoxyphenyl)sulfonylamino]-N-ethyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 35539470 |
| Molecular Formula | C19H24N2O5S2 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 2-[(2,5-dimethoxyphenyl)sulfonylamino]-N-ethyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CCNC(=O)c1c(NS(=O)(=O)c2cc(OC)ccc2OC)sc2c1CCCC2 |
| InChI | InChI=1S/C19H24N2O5S2/c1-4-20-18(22)17-13-7-5-6-8-15(13)27-19(17)21-28(23,24)16-11-12(25-2)9-10-14(16)26-3/h9-11,21H,4-8H2,1-3H3,(H,20,22) |
| InChIKey | MTUXJNMUGVRGSI-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_F(1)', 'substructure': 'N/A'} |
|---|