C17H17F2NO3S — CID 35548239
N-(4-cyclopentyloxyphenyl)-2,6-difluorobenzenesulfonamide (PubChem CID 35548239) has the molecular formula C17H17F2NO3S and a molecular weight of 353.39 g/mol. Its IUPAC name is N-(4-cyclopentyloxyphenyl)-2,6-difluorobenzenesulfonamide.
| Compound Name | N-(4-cyclopentyloxyphenyl)-2,6-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 35548239 |
| Molecular Formula | C17H17F2NO3S |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | N-(4-cyclopentyloxyphenyl)-2,6-difluorobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(OC2CCCC2)cc1)c1c(F)cccc1F |
| InChI | InChI=1S/C17H17F2NO3S/c18-15-6-3-7-16(19)17(15)24(21,22)20-12-8-10-14(11-9-12)23-13-4-1-2-5-13/h3,6-11,13,20H,1-2,4-5H2 |
| InChIKey | YADPMOFFVBXOAL-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |