C23H27N3O4S — CID 3557960
methyl 2-[[3-(4-ethoxyphenyl)-4-oxoquinazolin-2-yl]methylamino]-4-methylsulfanylbutanoate (PubChem CID 3557960) has the molecular formula C23H27N3O4S and a molecular weight of 441.55 g/mol. Its IUPAC name is methyl 2-[[3-(4-ethoxyphenyl)-4-oxoquinazolin-2-yl]methylamino]-4-methylsulfanylbutanoate.
| Compound Name | methyl 2-[[3-(4-ethoxyphenyl)-4-oxoquinazolin-2-yl]methylamino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 3557960 |
| Molecular Formula | C23H27N3O4S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | methyl 2-[[3-(4-ethoxyphenyl)-4-oxoquinazolin-2-yl]methylamino]-4-methylsulfanylbutanoate |
| SMILES | CCOc1ccc(-n2c(CNC(CCSC)C(=O)OC)nc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C23H27N3O4S/c1-4-30-17-11-9-16(10-12-17)26-21(15-24-20(13-14-31-3)23(28)29-2)25-19-8-6-5-7-18(19)22(26)27/h5-12,20,24H,4,13-15H2,1-3H3 |
| InChIKey | UEIBBHDKRGSEPA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |