C30H38N4O11S2 — CID 47011223
3-(4-ethoxyphenyl)-2-[[[1-(4-methylphenyl)-2-morpholin-4-ylethyl]amino]methyl]quinazolin-4-one;sulfuric acid (PubChem CID 47011223) has the molecular formula C30H38N4O11S2 and a molecular weight of 694.79 g/mol. Its IUPAC name is 3-(4-ethoxyphenyl)-2-[[[1-(4-methylphenyl)-2-morpholin-4-ylethyl]amino]methyl]quinazolin-4-one;sulfuric acid.
| Compound Name | 3-(4-ethoxyphenyl)-2-[[[1-(4-methylphenyl)-2-morpholin-4-ylethyl]amino]methyl]quinazolin-4-one;sulfuric acid |
|---|---|
| PubChem CID | 47011223 |
| Molecular Formula | C30H38N4O11S2 |
| Molecular Weight | 694.79 g/mol |
| Exact Mass | 694.20 |
| IUPAC Name | 3-(4-ethoxyphenyl)-2-[[[1-(4-methylphenyl)-2-morpholin-4-ylethyl]amino]methyl]quinazolin-4-one;sulfuric acid |
| SMILES | CCOc1ccc(-n2c(CNC(CN3CCOCC3)c3ccc(C)cc3)nc3ccccc3c2=O)cc1.O=S(=O)(O)O.O=S(=O)(O)O |
| InChI | InChI=1S/C30H34N4O3.2H2O4S/c1-3-37-25-14-12-24(13-15-25)34-29(32-27-7-5-4-6-26(27)30(34)35)20-31-28(21-33-16-18-36-19-17-33)23-10-8-22(2)9-11-23;2*1-5(2,3)4/h4-15,28,31H,3,16-21H2,1-2H3;2*(H2,1,2,3,4) |
| InChIKey | BNQRUIKGTLXWNR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 217.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.79 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|